Identification |
Name: | 2-Butenedioic acid (Z)-, bis(2-ethylhexyl) ester, polymer with N-ethenyl-N-methylacetamide N-Vinyl-N-methylacetamide, di-2-ethylhexyl maleate polymer |
Synonyms: | 2-Butenedioic acid (Z)-, bis(2-ethylhexyl) ester, polymer with N-ethenyl-N-methylacetamide N-Vinyl-N-methylacetamide, di-2-ethylhexyl maleate polymer;2-Butenedioic acid (Z)-, bis(2-ethylhexyl) ester, polymer with N-ethenyl-N-methylacetamide |
CAS: | 39936-45-3 |
Molecular Formula: | C25H45NO5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C20H36O4.C5H9NO/c1-5-9-11-17(7-3)15-23-19(21)13-14-20(22)24-16-18(8-4)12-10-6-2;1-4-6(3)5(2)7/h13-14,17-18H,5-12,15-16H2,1-4H3;4H,1H2,2-3H3/b14-13-; |
Molecular Structure: |
 |
Properties |
Flash Point: | 190.4°C |
Boiling Point: | 409.8°C at 760 mmHg |
Flash Point: | 190.4°C |
Safety Data |
|
 |