Identification |
Name: | L-Threonine, methylester, hydrochloride (1:1) |
CAS: | 39994-75-7 |
EINECS: | 254-738-5 |
Molecular Formula: | C5H11NO3.HCl |
Molecular Weight: | 169.61 |
InChI: | InChI=1/C5H11NO3.ClH/c1-3(7)4(6)5(8)9-2;/h3-4,7H,6H2,1-2H3;1H/t3?,4-;/m0./s1 |
Molecular Structure: |
|
Properties |
Transport: | OTH |
Melting Point: | clear to yellowish liquid
|
Density: | g/cm3 |
Solubility: |
Appearance:clear to yellowish liquid Transport Information: OTH Hazard Symbols:Not regulated
UN
NO. particular:particular
|
Appearance: | clear to yellowish liquid |
Storage Temperature: | −20°C |
Safety Data |
Hazard Symbols |
|
|
|