| Identification | |
| Name: | 2-(Aminomethyl)cyclohexanamine |
| Synonyms: | Cyclohexanemethanamine, 2-amino-;2-(aminomethyl)cyclohexan-1-amine;2-(Aminomethyl)cyclohexylamine; |
| CAS: | 40015-92-7 |
| Molecular Formula: | C7H16N2 |
| Molecular Weight: | 128.21 |
| InChI: | InChI=1/C7H16N2/c8-5-6-3-1-2-4-7(6)9/h6-7H,1-5,8-9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 86.3°C |
| Boiling Point: | 200.3°C at 760 mmHg |
| Density: | 0.923g/cm3 |
| Refractive index: | 1.48 |
| Specification: |
The 2-(Aminomethyl)cyclohexanamine, with CAS registry number 40015-92-7, has the systematic name of 2-(aminomethyl)cyclohexanamine. And its IUPAC name is 2-(aminomethyl)cyclohexan-1-amine. Besides this, it is also called cyclohexanemethanamine, 2-amino-. And the chemical formula of this chemical is C7H16N2. Physical properties of 2-(Aminomethyl)cyclohexanamine: (1)ACD/LogP: 0.23; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 4; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 6.48 Å2; (7)Index of Refraction: 1.48; (8)Molar Refractivity: 39.45 cm3; (9)Molar Volume: 138.7 cm3; (10)Polarizability: 15.64×10-24cm3; (11)Surface Tension: 37.5 dyne/cm; (12)Enthalpy of Vaporization: 43.66 kJ/mol; (13)Vapour Pressure: 0.326 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 86.3°C |
| Safety Data | |
 |
|
