| Identification | |
| Name: | p-Dithiane-2,5-diol |
| Synonyms: | 2,5-Dihydroxy-1,4-dithiane; 1,4-Dithiane-2,5-diol; Mercaptoacetaldehyde dimer |
| CAS: | 40018-26-6 |
| EINECS: | 254-751-6 |
| Molecular Formula: | C4H8O2S2 |
| Molecular Weight: | 152.23 |
| InChI: | InChI=1/C4H8O2S2/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 |
| Density: | 1.531 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.689 |
| Solubility: | 3.9 g/L (20 oC) in water |
| Appearance: | white to light yellow crystalline powder. |
| Specification: |
?2,5-Dihydroxy-1,4-dithiane , its cas register number is 40018-26-6. It also can be called?2,5-Dihydroxy-1,4-dithiane ; 1,4-Dithiane-2,5-diol ; 4-Dithiane-2,5-diol .It is a?white to yellowish crystalline powder. |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
