| Identification | |
| Name: | Thiophene,2-bromo-3-(bromomethyl)- |
| Synonyms: | 2-Bromo-3-(bromoethyl)thiophene;2-Bromo-3-bromomethylthiophene; 2-Bromo-3-thenyl bromide |
| CAS: | 40032-76-6 |
| Molecular Formula: | C5H4 Br2 S |
| Molecular Weight: | 255.96 |
| InChI: | InChI=1/C5H4Br2S/c6-3-4-1-2-8-5(4)7/h1-2H,3H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110 oC |
| Boiling Point: | 70-76/0.8mm |
| Density: | 1.967 |
| Refractive index: | 1.638 |
| Specification: |
2-Bromo-3-bromomethylthiophene with cas registry number of 40032-76-6 is also known as 2-Bromo-3-(bromomethyl)thiophene ; Thiophene, 2-bromo-3-(bromomethyl)- ; 2-Bromo-3-(Bromomethyl) Thiophene ; 2-Bromo-3-bromomethylthiophene ; 2-Bromo-3-bromomethyl-thiophene . It is a compound which should be stored in a cool,dry place . It would emit acrid smoke and irritating fumes when heated to decomposition . 2-Bromo-3-bromomethylthiophene with cas registry number of 40032-76-6 is used as a pharmaceutical intermediate . |
| Flash Point: | 110 oC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
