| Identification | |
| Name: | 2-[p-[Bis(2-chloroethyl)amino]phenyl]-N-ethylacetamide |
| Synonyms: | 2-[p-[Bis(2-chloroethyl)amino]phenyl]-N-ethylacetamide;NSC-122053 |
| CAS: | 40068-20-0 |
| Molecular Formula: | C14H20Cl2N2O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H20Cl2N2O/c1-2-17-14(19)11-12-3-5-13(6-4-12)18(9-7-15)10-8-16/h3-6H,2,7-11H2,1H3,(H,17,19) |
| Molecular Structure: | ![(C14H20Cl2N2O) 2-[p-[Bis(2-chloroethyl)amino]phenyl]-N-ethylacetamide;NSC-122053](https://img.guidechem.com/crawlimg/40068-20-0.png) |
| Properties | |
| Flash Point: | 255.1°C |
| Boiling Point: | 498.2°C at 760 mmHg |
| Density: | 1.189g/cm3 |
| Refractive index: | 1.556 |
| Specification: |
2-[p-[Bis(2-chloroethyl)amino]phenyl]-N-ethylacetamide ,its cas register number is 40068-20-0. It also can be called Acetamide,2-(p-(bis(2-chloroethyl)amino)phenyl)-N-ethyl- and Benzeneacetamide,4-(bis(2-chloroethyl)amino)-N-ethyl- . |
| Flash Point: | 255.1°C |
| Safety Data | |
 |
|
