| Identification | |
| Name: | 1,2-Ethanediamine,N1,N2-bis(1-methylethyl)- |
| Synonyms: | 1,2-Ethanediamine,N,N'-bis(1-methylethyl)- (9CI); Ethylenediamine, N,N'-diisopropyl-(6CI,7CI,8CI); 1,2-Bis(isopropylamino)ethane;N,N'-Diisopropyl-1,2-diaminoethane; N,N'-Diisopropyl-1,2-ethanediamine;N,N'-Diisopropylethylenediamine |
| CAS: | 4013-94-9 |
| EINECS: | 223-666-6 |
| Molecular Formula: | C8H20 N2 |
| Molecular Weight: | 144.26 |
| InChI: | InChI=1/C8H20N2/c1-7(2)9-5-6-10-8(3)4/h7-10H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2733 |
| Density: | 0.798 |
| Refractive index: | 1.4279-1.4299 |
| Appearance: | clear, colorless liquid |
| Specification: | clear colorless liquid Safety Statements:16-26-27-36/37/39-45-25 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 25:Avoid contact with eyes |
| Packinggroup: | III |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
