| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 2-chloro-, methyl ester |
| Synonyms: | Nicotinicacid, 2-chloro-, methyl ester (6CI);2-Chloro-3-methoxycarbonylpyridine;2-Chloronicotinic acid methyl ester;Methyl 2-chloronicotinate; |
| CAS: | 40134-18-7 |
| EINECS: | 254-805-9 |
| Molecular Formula: | C7H6ClNO2 |
| Molecular Weight: | 171.58 |
| InChI: | InChI=1/C7H6ClNO2/c1-11-7(10)5-3-2-4-9-6(5)8/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110 oC |
| Density: | 1.314 |
| Refractive index: | 1.537 |
| Appearance: | white or almost white solid |
| Specification: |
3-Pyridinecarboxylicacid, 2-chloro-, methyl ester , its cas register number is 40134-18-7. It also can be called Methyl 2-chloronicotinate . 3-Pyridinecarboxylicacid, 2-chloro-, methyl ester (CAS NO.40134-18-7) is irritating to eyes. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Flash Point: | 110 oC |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
