| Identification | |
| Name: | Acetamide,N-[(acetylamino)methyl]-2-chloro-N-(2,6-diethylphenyl)- |
| Synonyms: | 2-Chloro-2',6'-diethyl-N-(acetamidomethyl)acetanilide;Amidochlor; Limit; MON 4620; MON 4621 |
| CAS: | 40164-67-8 |
| Molecular Formula: | C15H21 Cl N2 O2 |
| Molecular Weight: | 296.83 |
| InChI: | InChI=1S/C15H21ClN2O2/c1-4-12-7-6-8-13(5-2)15(12)18(14(20)9-16)10-17-11(3)19/h6-8H,4-5,9-10H2,1-3H3,(H,17,19) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 271.1°C |
| Boiling Point: | 524.6°Cat760mmHg |
| Density: | 1.154g/cm3 |
| Specification: |
N-((Acetylamino)methyl)-2-chloro-N-(2,6-diethylphenyl)acetamide (CAS NO.40164-67-8) is also named as Amidochlor ; 2-((Acetylamino)methyl)-2-chloro-N-(2,6-diethylphenyl)acetamide ; BRN 2153508 ; Caswell No. 005B ; EPA Pesticide ; Chemical Code 128001 ; Limit ; MON 4620 ; MON 4621 ; Acetamide, N-((acetylamino)methyl)-2-chloro-N-(2,6-diethylphenyl)- . N-((Acetylamino)methyl)-2-chloro-N-(2,6-diethylphenyl)acetamide (CAS NO.40164-67-8) is toxic. It is flammable. It will produce toxic nitrogen oxide and chloride smoke by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Report: |
EPA FIFRA 1988 pesticide subject to registration or re-registration. |
| Flash Point: | 271.1°C |
| Safety Data | |
 |
|
