Identification |
Name: | 3-CHLOROCATECHOL |
Synonyms: | 1-CHLORO-2,3-DIHYDROXYBENZENE;3-CHLOROCATECHOL;3-MONOCHLOROCATECHOL;3-CHLOROCATECHOL 98+%;3-Chloro-1,2-benzenediol;3-Chloropyrocatechol;3-chlorobenzene-1,2-diol |
CAS: | 4018-65-9 |
Molecular Formula: | C6H5ClO2 |
Molecular Weight: | 144.56 |
InChI: | InChI=1/C6H5ClO2/c7-4-2-1-3-5(8)6(4)9/h1-3,8-9H |
Molecular Structure: |
 |
Properties |
Melting Point: | 49 °C |
Flash Point: | 97.1°C |
Boiling Point: | 138 °C / 20mmHg |
Density: | 1.471g/cm3 |
Refractive index: | 1.629 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 97.1°C |
Safety Data |
|
 |