| Identification | |
| Name: | TIENILIC ACID |
| Synonyms: | (2,3-dichloro-4-(2-thenoyl)phenoxy)aceticacid;(2,3-dichloro-4-(2-thienylcarbonyl)phenoxy)-aceticaci;(2,3-dichloro-4-(2-thienylcarbonyl)phenoxy)aceticacid;(2,3-dichloro-4-(2-thiophenecarbonyl)phenoxy)aceticacid;4-(2-theonyl)-2,3-dichlorphenoxyessigsaeure;4-(2-thienylketo)-2,3-dichlorophenoxyaceticacid;anp3624;ce3624 |
| CAS: | 40180-04-9 |
| EINECS: | 254-826-3 |
| Molecular Formula: | C13H8Cl2O4S |
| Molecular Weight: | 331.17 |
| InChI: | InChI=1/C13H8Cl2O4S/c14-11-7(13(18)9-2-1-5-20-9)3-4-8(12(11)15)19-6-10(16)17/h1-5H,6H2,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 148-149oC |
| Flash Point: | 277.1°C |
| Boiling Point: | 534.6°C at 760 mmHg |
| Density: | 1.532g/cm3 |
| Refractive index: | 1.632 |
| Specification: |
Tienilic acid ,its CAS NO. is 40180-04-9,the synonyms is (2,3-Dichloro-4-(2-thenoyl)phenoxy)acetic acid |
| Flash Point: | 277.1°C |
| Usage: |
Tienilic acid (CAS NO.40180-04-9) (INN and BAN) or ticrynafen (USAN) is a diuretic drug with uric acid-lowering (uricosuric) action, formerly marketed for the treatment of hypertension. It was withdrawn in 1982, shortly after its introduction to the market, after case reports in the United States indicated a link between the use of ticrynafen and hepatitis. |
| Safety Data | |
 |
|
