| Identification | |
| Name: | 6-Fluoropyridine-2-carboxylic acid |
| Synonyms: | 6-Fluoropicolinic acid; 2-Pyridinecarboxylic acid, 6-fluoro- |
| CAS: | 402-69-7 |
| EINECS: | None |
| Molecular Formula: | C6H4FNO2 |
| Molecular Weight: | 141.1 |
| InChI: | InChI=1/C5H3BrFN/c6-5-4(7)2-1-3-8-5/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.419 g/cm3 |
| Refractive index: | 1.533 |
| Appearance: | White powder |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
