| Identification | |
| Name: | Phosphinous acid,P,P-diphenyl-, methyl ester |
| Synonyms: | Phosphinousacid, diphenyl-, methyl ester (6CI,7CI,8CI,9CI); Diphenylmethoxyphosphine;Methoxydiphenylphosphine; Methyl diphenylphosphinite; NSC 171167 |
| CAS: | 4020-99-9 |
| EINECS: | 223-683-9 |
| Molecular Formula: | C13H13 O P |
| Molecular Weight: | 216.22 |
| InChI: | InChI=1/C13H13OP/c1-14-15(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Flash Point: | >230 °F |
| Density: | 1.078 |
| Refractive index: | 1.6045-1.6065 |
| Specification: | Colorless to light yellow liqui Safety Statements:26-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Flash Point: | >230 °F |
| Storage Temperature: | 0-6°C |
| Sensitive: | Air & Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
