| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 2-methyl- |
| Synonyms: | Isonicotinicacid, 2-methyl- (6CI,7CI,8CI);2-Methyl-4-pyridinecarboxylic acid;2-Picoline-4-carboxylic acid; |
| CAS: | 4021-11-8 |
| Molecular Formula: | C7H7NO2 |
| Molecular Weight: | 137.14 |
| InChI: | InChI=1/C7H7NO2/c1-5-4-6(7(9)10)2-3-8-5/h2-4H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 176.5°C |
| Boiling Point: | 368.2°C at 760 mmHg |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.561 |
| Specification: | Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 176.5°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
