| Identification | |
| Name: | Cyclopropanecarboxylic acid chloride |
| Synonyms: | Cyclopropanecarbonyl chloride;Cyclopropane Carbonyl Chloride;Cyclopropanoyl Chloride; |
| CAS: | 4023-34-1 |
| EINECS: | 223-684-4 |
| Molecular Formula: | C4H5ClO |
| Molecular Weight: | 104.53 |
| InChI: | InChI=1/C4H5ClO/c5-4(6)3-1-2-3/h3H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 |
| Density: | 1.152 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4515-1.4535 |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | Clear colorless to slightly yellow liquid. |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:26-36/37/39-45-8-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 8:Keep container dry 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | II |
| HS Code: | 29162000 |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
