| Identification | |
| Name: | Propanenitrile,3,3',3''-phosphinidynetris- |
| Synonyms: | Propionitrile,3,3',3'-phosphinidynetri- (7CI);Propionitrile, 3,3',3''-phosphinidynetri-(6CI,8CI);NSC 41940;Phosphine, tris(2-cyanoethyl)-;Tris(2-cyanoethyl)phosphine;Tris(b-cyanoethyl)phosphine; |
| CAS: | 4023-53-4 |
| EINECS: | 223-687-0 |
| Molecular Formula: | C9H12N3P |
| Molecular Weight: | 193.185441 |
| InChI: | InChI=1S/C9H12N3P/c10-4-1-7-13(8-2-5-11)9-3-6-12/h1-3,7-9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3464 |
| Density: | g/cm3 |
| Water Solubility: | Soluble in DMSO and H2O |
| Solubility: | Soluble in DMSO and H2O |
| Appearance: | white Crystalline |
| Packinggroup: | II |
| Sensitive: | Air & Moisture Sensitive |
| Safety Data | |
 |
|
