| Identification | |
| Name: | 2-Propanone,1-(acetyloxy)-3-chloro- |
| Synonyms: | 2-Propanone,1-chloro-3-hydroxy-, acetate (6CI); 1-Acetoxy-3-chloro-2-propanone;1-Acetoxy-3-chloroacetone; 1-Acetyloxy-3-chloroacetone;1-Chloro-3-acetoxy-2-propanone; 3-Chloro-2-oxo-1-propanol, acetate;3-Chloro-2-oxopropyl acetate; Chloroacetol acetate |
| CAS: | 40235-68-5 |
| Molecular Formula: | C5H7 Cl O3 |
| Molecular Weight: | 150.56 |
| InChI: | InChI=1/C5H7ClO3/c1-4(7)9-3-5(8)2-6/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2922 |
| Flash Point: | 86.4°C |
| Boiling Point: | 200.9°Cat760mmHg |
| Density: | 1.223g/cm3 |
| Refractive index: | 1.431 |
| Specification: | Safety Statements:23-26-36/37/39 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 86.4°C |
| Safety Data | |
 |
|
