Identification |
Name: | Benzaldehyde,3-methoxy-, 2-[(3-methoxyphenyl)methylene]hydrazone |
Synonyms: | Benzaldehyde,3-methoxy-, [(3-methoxyphenyl)methylene]hydrazone (9CI); m-Anisaldehyde, azine (6CI);3,3'-Dimethoxybenzaldazine |
CAS: | 40252-74-2 |
Molecular Formula: | C16H16 N2 O2 |
Molecular Weight: | 268.31 |
InChI: | InChI=1/C16H16N2O2/c1-19-15-7-3-5-13(9-15)11-17-12-18-14-6-4-8-16(10-14)20-2/h3-12H,1-2H3/b17-11+,18-12+ |
Molecular Structure: |
![(C16H16N2O2) Benzaldehyde,3-methoxy-, [(3-methoxyphenyl)methylene]hydrazone (9CI); m-Anisaldehyde, azine (6CI);3,...](https://img1.guidechem.com/chem/e/dict/18/40252-74-2.jpg) |
Properties |
Transport: | UN 3077 9/PG 3 |
Flash Point: | 176.1°C |
Boiling Point: | 438.2°Cat760mmHg |
Density: | 1.05g/cm3 |
Refractive index: | 1.54 |
Biological Activity: | Negative allosteric modulator of the metabotropic glutamate receptor mGlu 5 ; displays reversible non-competitive inhibition of mGlu 5 -mediated responses (IC 50 = 3 μ M). |
Flash Point: | 176.1°C |
Storage Temperature: | 2-8°C |
Color: | yellow |
Safety Data |
Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
|
 |