| Identification | |
| Name: | Tributyltin nonanoate |
| Synonyms: | (Nonanoyloxy)tributylstannane |
| CAS: | 4027-14-9 |
| Molecular Formula: | C21H44O2Sn |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H18O2.3C4H9.Sn/c1-2-3-4-5-6-7-8-9(10)11;3*1-3-4-2;/h2-8H2,1H3,(H,10,11);3*1,3-4H2,2H3;/rC12H27Sn.C9H18O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-3-4-5-6-7-8-9(10)11/h4-12H2,1-3H3;2-8H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Tributyltin nonanoate , its cas register number is 4027-14-9. It also can be called (Nonanoyloxy)tributylstannane ; Nonanoic acid, tributylstannyl ester ; and Stannane, (nonanoyloxy)tributyl- . |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
