| Identification | |
| Name: | 2-bromo-1-(4-fluorophenyl)ethan-1-one |
| Synonyms: | P-FLUOROPHENACYL BROMIDE; TIMTEC-BB SBB006561; Bromo-4-fluoroacetophenone; Ethanone, 2-bromo-1-(4-fluorophenyl)-; omega-Bromo-4-fluoroacetophenone; BUTTPARK 41\03-58; 2-BROMO-1-(4-FLUOROPHENYL)ETHANONE; 2'-BROMO-4-FLUOROACETOPHENONE; 2-bromo-4'-fluoroacetophenone; 2-Bromo-4'-fluoroacetophentone |
| CAS: | 403-29-2 |
| EINECS: | 206-955-1 |
| Molecular Formula: | C8H6BrFO |
| Molecular Weight: | 217.03 |
| InChI: | InChI=1/C8H6BrFO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.568 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Sparomg;u sp;ib;e |
| Appearance: | beige to light grey-green cryst. powder or flakes |
| Specification: |
?2-Bromo-1-(4-fluorophenyl)ethan-1-one (CAS NO.403-29-2) is also named as 2-Bromo-1-(4-fluorophenyl)ethanone?; Acetophenone, 2-bromo-4'-fluoro- ; Ethanone, 2-bromo-1-(4-fluorophenyl)- ; p-Fluorophenacyl bromide ; 2-Bromo-1-(4-fluoro-phenyl)-ethanone ; 2-Bromo-4'-fluoroacetophenone .?2-Bromo-1-(4-fluorophenyl)ethan-1-one (CAS NO.403-29-2) is?beige to light grey-green cryst. powder or flakes. |
| Packinggroup: | III |
| Storage Temperature: | Keep Cold |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
