| Identification |
| Name: | Ethanone,1-(4-fluorophenyl)- |
| Synonyms: | Acetophenone,4'-fluoro- (6CI,7CI,8CI);1-(4-Fluorophenyl)ethan-1-one;1-(4-Fluorophenyl)ethanone;1-Acetyl-4-fluorobenzene;4-Acetylfluorobenzene;4-Acetylphenyl fluoride;4-Fluorophenyl methyl ketone;4-Fluorophenylethanal;Methyl 4-fluorophenyl ketone;NSC 30635;p-Fluoroacetophenone;p-Fluorohypnone;p-Fluorophenyl methyl ketone;4-Fluoroacetophenone; |
| CAS: | 403-42-9 |
| EINECS: | 206-960-9 |
| Molecular Formula: | C8H7FO |
| Molecular Weight: | 138.14 |
| InChI: | InChI=1/C8H7FO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.138 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.51-1.512 |
| Solubility: | Slightly soluble |
| Appearance: | light yellow clear liquid. |
| HS Code: | 29147090 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
