| Identification | |
| Name: | Arsinous chloride,As,As-bis(2-chloroethenyl)- |
| Synonyms: | Arsine,chlorobis(2-chlorovinyl)- (6CI); Arsinous chloride, bis(2-chloroethenyl)-(9CI); Lewisite 2; Lewisite II |
| CAS: | 40334-69-8 |
| Molecular Formula: | C4H4 As Cl3 |
| Molecular Weight: | 233.35 |
| InChI: | InChI=1/C4H4AsCl3/c6-3-1-5(8)2-4-7/h1-4H/b3-1+,4-2+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 94.9°C |
| Boiling Point: | 228.9°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Lewisite 2 ,its CAS NO. is 40334-69-8,the synonyms is Bis(2-chlorovinyl)chloroarsine ; Dichlorovinylarsine chloride ; Arsine, bis(2-chlorovinyl)chloro- . |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 94.9°C |
| Safety Data | |
 |
|
