| Identification | |
| Name: | 1,2-Butanediol, (2R)- |
| Synonyms: | 1,2-Butanediol,(R)-;(-)-1,2-Butanediol;(R)-(-)-1,2-Butanediol;(R)-1,2-Butanediol; |
| CAS: | 40348-66-1 |
| Molecular Formula: | C4H10O2 |
| Molecular Weight: | 90.12 |
| InChI: | InChI=1/C4H10O2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3/t4-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.001g/cm3 |
| Refractive index: | 1.437 |
| Specification: |
The (R)-1,2-Butanediol, with cas registry number 40348-66-1, belongs to the following product categories: API intermediates. It has the systematic name of (2R)-butane-1,2-diol. And it is also called 1,2-butanediol, (2R)-. Physical properties about this chemical are: (1)CD/LogP: -0.81; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.81; (4)ACD/LogD (pH 7.4): -0.81; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 8.64; (8)ACD/KOC (pH 7.4): 8.64; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 18.46 Å2; (13)Index of Refraction: 1.437; (14)Molar Refractivity: 23.6 cm3; (15)Molar Volume: 89.9 cm3; (16)Polarizability: 9.35×10-24cm3; (17)Surface Tension: 37.1 dyne/cm; (18)Enthalpy of Vaporization: 49.64 kJ/mol; (19)Vapour Pressure: 0.148 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
