| Identification | |
| Name: | Butanedioic acid,2-phenyl-, (2S)- |
| Synonyms: | Butanedioicacid, phenyl-, (2S)- (9CI);Butanedioic acid, phenyl-, (S)-;Succinic acid,phenyl-, D-(+)- (8CI);(+)-2-Phenylsuccinic acid;(+)-Phenylsuccinic acid;(S)-(+)-Phenylsuccinic acid;(S)-2-Phenylsuccinic acid;(S)-Phenylsuccinic acid; |
| CAS: | 4036-30-0 |
| EINECS: | 223-719-3 |
| Molecular Formula: | C10H10O4 |
| Molecular Weight: | 194.19 |
| InChI: | InChI=1/C10H10O4/c11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 154.2°C |
| Boiling Point: | 307.8°Cat760mmHg |
| Density: | 1.336g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 147.5 ° (C=2, EtOH) |
| Alpha: | 168 º (C=1, ACETONE) |
| Solubility: | Very soluble |
| Appearance: | Almost white. |
| Specification: | almost white micro-crystalline powder Safety Statements:22-24/25-37/39-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 154.2°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Chiral intermediate. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
