| Identification | |
| Name: | 5-Bromoindole-3-acetic acid |
| Synonyms: | - |
| CAS: | 40432-84-6 |
| EINECS: | 254-917-8 |
| Molecular Formula: | C10H8BrNO2 |
| Molecular Weight: | 254.08 |
| InChI: | InChI=1/C10H8BrNO2/c11-7-1-2-9-8(4-7)6(5-12-9)3-10(13)14/h1-2,4-5,12H,3H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 235.6°C |
| Boiling Point: | 466°Cat760mmHg |
| Density: | 1.746g/cm3 |
| Appearance: | Off-white to beige crystalline powder |
| Specification: | OFF-WHITE TO BEIGE CRYSTALLINE POWDER Safety Statements:24/25-36-26-22 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust |
| HS Code: | 29339990 |
| Flash Point: | 235.6°C |
| Safety Data | |
 |
|
