| Identification | |
| Name: | Benzene,1,4-diisothiocyanato- |
| Synonyms: | Isothiocyanicacid, p-phenylene ester (6CI,7CI,8CI); 1,4-Diisothiocyanatobenzene; Bitoscanat;Bitoscanate; Jonit; PDITC; Phenylene-1,4-diisothiocyanate; WM 842; p-Phenylenebisisothiocyanate; p-Phenylene diisothiocyanate |
| CAS: | 4044-65-9 |
| EINECS: | 223-741-3 |
| Molecular Formula: | C8H4 N2 S2 |
| Molecular Weight: | 192.253 |
| InChI: | InChI=1/C8H4N2S2/c11-5-9-7-1-2-8(4-3-7)10-6-12/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 129-131 ºC(lit.) |
| Flash Point: | 167.2°C |
| Boiling Point: | 339.4°C at 760 mmHg |
| Density: | 1.2g/cm3 |
| Refractive index: | 1.641 |
| Water Solubility: | chloroform: clear |
| Solubility: | chloroform: clear |
| Appearance: | powder white |
| Specification: | off-white to yellow to beige-grey crystalline usageEng:Reagent for solid-phase sequencing. Safety Statements:22-26-36/37 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. EPA Extremely Hazardous Substances List. Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 167.2°C |
| Storage Temperature: | −20°C |
| Sensitive: | Moisture Sensitive |
| Color: | white |
| Usage: | Reagent for solid-phase sequencing. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
