Identification |
Name: | Benzonitrile,3-fluoro-4-hydroxy- |
Synonyms: | 3-Fluoro-4-hydroxybenzonitrile;4-Cyano-2-fluorophenol;4-Hydroxy-3-fluorobenzonitrile; |
CAS: | 405-04-9 |
Molecular Formula: | C7H4FNO |
Molecular Weight: | 137.11 |
InChI: | InChI=1/C7H4FNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H |
Molecular Structure: |
 |
Properties |
Transport: | 3439 |
Flash Point: | 90.2°C |
Boiling Point: | 225.6°Cat760mmHg |
Density: | 1.35g/cm3 |
Refractive index: | 1.558 |
Specification: | Safety Statements:26-36/37/39-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | III |
Flash Point: | 90.2°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |