| Identification | |
| Name: | 4-Chloro-1,8-naphthalic anhydride |
| Synonyms: | 4-chloronaphthalene-1,8-dicarboxylic anhydride; 4-Chloronaphthalene-1,8-Naphthalic Anhydride |
| CAS: | 4053-08-1 |
| EINECS: | 223-760-7 |
| Molecular Formula: | C12H5ClO3 |
| Molecular Weight: | 232.62 |
| InChI: | InChI=1/C12H5ClO3/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)16-12(8)15/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.565 g/cm3 |
| Refractive index: | 1.715 |
| Appearance: | beige to brown powder |
| Specification: |
1H,3H-Naphtho(1,8-cd)pyran-1,3-dione, 6-chloro- , with CAS number of 4053-08-1, can be called 1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 6-chloro- ; 6-Chloro-1H,3H-benzo[de]isochromene-1,3-dione ; 4-Chloro-1,8-naphthalic anhydride ; 6-Chloro-1H,3H-naphtho(1,8-cd)pyran-1,3-dione . It is a beige to brown powder, 1H,3H-Naphtho(1,8-cd)pyran-1,3-dione, 6-chloro- (CAS NO.4053-08-1) is used as synthetic dyes, pigments, fluorescent brighteners and other important raw materials. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
