| Identification | |
| Name: | dibutyl (Z)-but-2-enedioate; 1-ethenylpyrrolidin-2-one |
| Synonyms: | 2-Butenedioic acid (2Z)-, dibutyl ester, polymer with 1-ethenyl-2-pyrrolidinone;2-Butenedioic acid (Z)-, dibutyl ester, polymer with 1-ethenyl-2-pyrrolidinone 2-butenedioic acid (z)-, dibutyl ester, polymer with1-ethenyl-2-pyrrolidinone 2-Butenedioic acid(Z)-,dibutyl ester,polymer with 1-ethenyl-2-pyrrolidinone;2-Butenedioic acid (Z)-, dibutyl ester, polymer with 1-ethenyl-2-pyrrolidinone |
| CAS: | 40544-68-1 |
| Molecular Formula: | C18H29NO5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H20O4.C6H9NO/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2;1-2-7-5-3-4-6(7)8/h7-8H,3-6,9-10H2,1-2H3;2H,1,3-5H2/b8-7-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 136.4°C |
| Boiling Point: | 280°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 136.4°C |
| Safety Data | |
 |
|
