| Identification | |
| Name: | 2H-1-Benzopyran-2-one,3,4-dihydro-6-methyl-4-phenyl- |
| Synonyms: | Hydrocoumarin,6-methyl-4-phenyl- (6CI,7CI);3,4-Dihydro-6-methyl-4-phenyl-2H-benzopyran-2-one;6-Methyl-4-phenyl-3,4-dihydro-1-benzopyran-2-one;6-Methyl-4-phenyl-3,4-dihydrocoumarin; |
| CAS: | 40546-94-9 |
| Molecular Formula: | C16H14O2 |
| Molecular Weight: | 238.28 |
| InChI: | InChI=1/C16H14O2/c1-11-7-8-15-14(9-11)13(10-16(17)18-15)12-5-3-2-4-6-12/h2-9,13H,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.3°C |
| Boiling Point: | 351.1°C at 760 mmHg |
| Density: | 1.166g/cm3 |
| Refractive index: | 1.595 |
| Specification: |
2H-1-Benzopyran-2-one,3,4-dihydro-6-methyl-4-phenyl- , with CAS number of 40546-94-9, can be called 6-Methyl-4-phenylchroman-2-one ; 3,4-dihydro-6-methyl-4-phenyl-2h-1-benzopyran-2-one ; 6-methyl-4-phenyl-3,4-dihydrovanillin ; 6-methyl-4-phenyl-3,4-dihydrovanillin(fortolterodine-l-tartrate) ; fortolterodine-l-tartrate ; 6-methyl-4-phenyl-3,4-dihydro-2h-1-benzopyran-2-one ; 6-methyl-4-phenyl-chroman-one ; 6-methyl-4-phenyl-3,4-dihydro-2h-1-benzopyran . |
| Flash Point: | 146.3°C |
| Storage Temperature: | Refrigerator |
| Usage: | Intermediate in the production of Tolterodine. |
| Safety Data | |
 |
|
