| Identification | |
| Name: | Boronic acid,B-[4-[(dimethylamino)carbonyl]phenyl]- |
| Synonyms: | Boronicacid, [4-[(dimethylamino)carbonyl]phenyl]- (9CI);(4-(Dimethylaminocarbonyl)phenyl)boronic acid;4-Dimethylcarbamoylphenylboronicacid;[4-(N,N-Dimethylcarbamoyl)phenyl]boronic acid; |
| CAS: | 405520-68-5 |
| Molecular Formula: | C9H12BNO3 |
| Molecular Weight: | 193.00748 |
| InChI: | InChI=1S/C9H12BNO3/c1-11(2)9(12)7-3-5-8(6-4-7)10(13)14/h3-6,13-14H,1-2H3 |
| Molecular Structure: | ![(C9H12BNO3) Boronicacid, [4-[(dimethylamino)carbonyl]phenyl]- (9CI);(4-(Dimethylaminocarbonyl)phenyl)boronic aci...](https://img1.guidechem.com/chem/e/dict/27/405520-68-5.jpg) |
| Properties | |
| Density: | 1.2 g/cm3 |
| Refractive index: | 1.553 |
| Water Solubility: | at 25 deg C (mg/L): 2.045e+004 |
| Solubility: | at 25 deg C (mg/L): 2.045e+004 |
| Specification: |
4-( N,N -Dimethylcarbamoyl)phenylboronic acid , its cas register number is 405520-68-5. It also can be called [4-(Dimethylcarbamoyl)phenyl]boronic acid ; Boronic acid, B-[4-[(dimethylamino)carbonyl]phenyl]- ; 4-(Dimethylaminocarbonyl)benzeneboronic acid 97% and so on. The storage environment of 4-( N,N -Dimethylcarbamoyl)phenylboronic acid (CAS NO.405520-68-5) should be cold. |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
