| Identification | |
| Name: | 2H-Furo[2,3-h]-1-benzopyran-2-one,4,8-dimethyl- |
| Synonyms: | 5-Benzofuranacrylicacid, 4-hydroxy-b,2-dimethyl-,d-lactone (6CI,7CI);4,8-Dimethylisopsoralen; NSC 627260 |
| CAS: | 4063-41-6 |
| Molecular Formula: | C13H10 O3 |
| Molecular Weight: | 214.23 |
| InChI: | InChI=1/C13H10O3/c1-7-5-12(14)16-13-9(7)3-4-11-10(13)6-8(2)15-11/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 184.5°C |
| Boiling Point: | 381.5°Cat760mmHg |
| Density: | 1.273g/cm3 |
| Refractive index: | 1.624 |
| Report: |
IARC Cancer Review: Animal Inadequate Evidence IMEMDT IARC Monographs on the Evaluation of Carcinogenic Risk of Chemicals to Man . 40 ,1986,p. 291.(World Health Organization, Internation Agency for Research on Cancer,Lyon, France.: ) (Single copies can be ordered from WHO Publications Centre U.S.A., 49 Sheridan Avenue, Albany, NY 12210) . |
| Flash Point: | 184.5°C |
| Safety Data | |
 |
|
