Identification |
Name: | Benzenemethanamine, a-methyl-N-[(1S)-1-phenylethyl]-,hydrochloride (1:1), (aS)- |
Synonyms: | Benzenemethanamine,a-methyl-N-(1-phenylethyl)-,hydrochloride, [S-(R*,R*)]-; Benzenemethanamine, a-methyl-N-[(1S)-1-phenylethyl]-, hydrochloride, (aS)- (9CI) |
CAS: | 40648-92-8 |
Molecular Formula: | C16H19 N . Cl H |
Molecular Weight: | 226.3362 |
InChI: | InChI=1S/C16H19N/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16/h3-14,17H,1-2H3/p+1/t13-,14-/m0/s1 |
Molecular Structure: |
|
Properties |
Melting Point: | 261-263 °C(lit.) |
Flash Point: | 137.2°C |
Boiling Point: | 296.5°Cat760mmHg |
Density: | g/cm3 |
Refractive index: | -73 ° (C=3, EtOH) |
Specification: | white to light yellow crystal powde Safety Statements:26-36-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 137.2°C |
Safety Data |
|
|