| Identification | |
| Name: | Benzenemethanamine, a-methyl-N-[(1S)-1-phenylethyl]-,hydrochloride (1:1), (aS)- |
| Synonyms: | Benzenemethanamine,a-methyl-N-(1-phenylethyl)-,hydrochloride, [S-(R*,R*)]-; Benzenemethanamine, a-methyl-N-[(1S)-1-phenylethyl]-, hydrochloride, (aS)- (9CI) |
| CAS: | 40648-92-8 |
| Molecular Formula: | C16H19 N . Cl H |
| Molecular Weight: | 226.3362 |
| InChI: | InChI=1S/C16H19N/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16/h3-14,17H,1-2H3/p+1/t13-,14-/m0/s1 |
| Molecular Structure: | ![(C16H19N.ClH) Benzenemethanamine,a-methyl-N-(1-phenylethyl)-,hydrochloride, [S-(R*,R*)]-; Benzenemethanamine, a-me...](https://img1.guidechem.com/chem/e/dict/68/40648-92-8.jpg) |
| Properties | |
| Melting Point: | 261-263 °C(lit.) |
| Flash Point: | 137.2°C |
| Boiling Point: | 296.5°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | -73 ° (C=3, EtOH) |
| Specification: | white to light yellow crystal powde Safety Statements:26-36-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 137.2°C |
| Safety Data | |
 |
|
