| Identification | |
| Name: | 1-Butene, 1,1-difluoro- |
| Synonyms: | 1,1-Difluorobut-1-ene |
| CAS: | 407-09-0 |
| Molecular Formula: | C4H6 F2 |
| Molecular Weight: | 92.09 |
| InChI: | InChI=1/C4H6F2/c1-2-3-4(5)6/h3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3161 |
| Melting Point: | -144,9°C |
| Flash Point: | °C |
| Boiling Point: | 3,7°C |
| Density: | 0.931g/cm3 |
| Refractive index: | 1.3851 |
| Specification: | Safety Statements:16-23-33 16:Keep away from sources of ignition - No smoking 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 33:Take precautionary measures against static discharges |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
