| Identification | |
| Name: | 1H-Inden-1-one,2,3-dihydro-4-hydroxy- |
| Synonyms: | 4-Hydroxy-1-indanone;1-Indanone,4-hydroxy- (6CI);1-Oxo-4-indanol; |
| CAS: | 40731-98-4 |
| Molecular Formula: | C9H8O2 |
| Molecular Weight: | 148.16 |
| InChI: | InChI=1/C9H8O2/c10-8-3-1-2-6-7(8)4-5-9(6)11/h1-3,10H,4-5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.305g/cm3 |
| Refractive index: | 1.631 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
4-Hydroxyindan-1-one , its cas register number is 40731-98-4. It also can be called 1H-inden-1-one, 2,3-dihydro-4-hydroxy- ; 4-Hydroxy-2,3-dihydro-1H-inden-1-on . 4-Hydroxyindan-1-one (CAS NO.40731-98-4) is a white to light yellow crystal powder. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
