Identification |
Name: | Hexadecanoic acid,sodium salt (1:1) |
Synonyms: | Hexadecanoicacid, sodium salt (9CI);Palmitic acid, sodium salt (8CI);C-Lube 16;NonsoulPN 1;PN 1;Sodium hexadecanoate;Sodium palmitate;Sodiumpentadecanecarboxylate; |
CAS: | 408-35-5 |
EINECS: | 206-988-1 |
Molecular Formula: | C16H32NaO2 |
Molecular Weight: | 278.47 |
InChI: | InChI=1/C16H32O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18); |
Molecular Structure: |
 |
Properties |
Melting Point: | 283-290 °C(lit.)
|
Flash Point: | 154.1°C |
Boiling Point: | 340.6°Cat760mmHg |
Density: | g/cm3 |
Appearance: | white powder |
Specification: | white powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
Flash Point: | 154.1°C |
Storage Temperature: | 2-8°C |
Color: | WHITE CRYSTALS White to yellow powder |
Safety Data |
Hazard Symbols |
|
|
 |