| Identification |
| Name: | 4-Cyano-4'-n-pentylbiphenyl |
| Synonyms: | - |
| CAS: | 40817-08-1 |
| EINECS: | 255-093-2 |
| Molecular Formula: | C18H19N |
| Molecular Weight: | 249.35 |
| InChI: | InChI=1/C18H19N/c1-2-3-4-5-15-6-10-17(11-7-15)18-12-8-16(14-19)9-13-18/h6-13H,2-5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3276 |
| Density: | 1.008 |
| Refractive index: | 1.532 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | white to light yellow crystal |
| Packinggroup: | III |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
