| Identification | ||
| Name: | Benzeneacetic acid, a-methyl-4-(2-thienylcarbonyl)- | |
| CAS: | 40828-46-4 | |
| EINECS: | 255-096-9 | |
| Molecular Formula: | C14H12 O3 S | |
| Molecular Weight: | 260.31 | |
| InChI: | InChI=1/C14H12O3S/c1-9(14(16)17)10-4-6-11(7-5-10)13(15)12-3-2-8-18-12/h2-9H,1H3,(H,16,17) | |
| Molecular Structure: | ![(C14H12O3S) (?à)-Suprofen;2-[4-(Thiophene-2-carbonyl)phenyl]propanoic acid; Masterfen; NSC 303611;Profenal; Pro...](https://img.guidechem.com/casimg/40828-46-4.gif) |
|
| Properties | ||
| Transport: | 3249 | |
| Melting Point: | 278ºC | |
| Flash Point: | 221.5 ºC | |
| Boiling Point: | 442.6 ºC at 760 mmHg | |
| Density: | 1.29 g/cm3 | |
| Stability: | Stable at normal temperatures and pressures. | |
| Refractive index: | 1.612 | |
| Water Solubility: | soluble | |
| Solubility: | Water Solubility : soluble | |
| Specification: | Off-White to Light-Brown usageEng:Prostaglandin biosynthesis inhibitor. Analgesic | |
| Packinggroup: | III | |
| Flash Point: | 221.5 ºC | |
| Usage: | Prostaglandin biosynthesis inhibitor. Analgesic | |
| Safety Data | ||
 |
||
