Identification |
Name: | Benzeneacetic acid, a-methyl-4-(2-thienylcarbonyl)- |
CAS: | 40828-46-4 |
EINECS: | 255-096-9 |
Molecular Formula: | C14H12 O3 S |
Molecular Weight: | 260.31 |
InChI: | InChI=1/C14H12O3S/c1-9(14(16)17)10-4-6-11(7-5-10)13(15)12-3-2-8-18-12/h2-9H,1H3,(H,16,17) |
Molecular Structure: |
![(C14H12O3S) (?à)-Suprofen;2-[4-(Thiophene-2-carbonyl)phenyl]propanoic acid; Masterfen; NSC 303611;Profenal; Pro...](https://img.guidechem.com/casimg/40828-46-4.gif) |
Properties |
Transport: | 3249 |
Melting Point: | 278ºC |
Flash Point: | 221.5 ºC |
Boiling Point: | 442.6 ºC at 760 mmHg |
Density: | 1.29 g/cm3 |
Stability: | Stable at normal temperatures and pressures. |
Refractive index: | 1.612 |
Water Solubility: | | soluble |
Solubility: | Water Solubility : soluble |
Specification: | Off-White to Light-Brown usageEng:Prostaglandin biosynthesis inhibitor. Analgesic |
Packinggroup: | III |
Flash Point: | 221.5 ºC |
Usage: | Prostaglandin biosynthesis inhibitor. Analgesic |
Safety Data |
|
 |