Identification |
Name: | D-erythro-Hexos-2-ulose,3-deoxy- |
Synonyms: | D-erythro-Hexosulose,3-deoxy- (6CI,7CI,8CI); 2-keto-3-Deoxyglucose; 3-Deoxy-D-erythro-hexos-2-ulose;3-Deoxy-D-erythro-hexosulose; 3-Deoxy-D-glucosone; 3-Deoxyglucosone;D-3-Deoxyglucosone |
CAS: | 4084-27-9 |
Molecular Formula: | C6H10 O5 |
Molecular Weight: | 162.16 |
InChI: | InChI=1/C6H10O5/c7-2-4(9)1-5(10)6(11)3-8/h2,5-6,8,10-11H,1,3H2/t5-,6+/m0/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 209.9°C |
Boiling Point: | 400.1°Cat760mmHg |
Density: | 1.406g/cm3 |
Stability: | Hygroscopic |
Refractive index: | 1.511 |
Specification: |
d-3-Deoxyglucosone ,its CAS NO. is 4084-27-9,the synonyms is 3-Deoxy-d-erythro-hexos-2-ulose ; 3-Deoxy-d-erythro-hexosulos ; d-3-Deoxyglucosone ; 3Dg ; 3-Deoxy-d-erythro-hexulose2-keto-3-deoxyglucose ; 3-Deoxyglucosone ; 3-Deoxy-d-erythro-hexulose 2-keto-3-deoxyglucose 3dg ; 3-Deoxy-d-glucosone .
|
Flash Point: | 209.9°C |
Usage: |
An intermediate in the Maillard reaction of proteins with glucose, which is metabolised to 3-Deoxyfructose. An intermediate in the formation of pyrraline, which might contribute to a pathological effect, such as carcinogenesis.
|
Safety Data |
|
 |