| Identification | |
| Name: | Ethyl L-tyrosinate hydrochloride |
| CAS: | 4089-07-0 |
| EINECS: | 223-820-2 |
| Molecular Formula: | C11H16ClNO3 |
| Molecular Weight: | 245.7 |
| InChI: | InChI=1/C11H15NO3.ClH/c1-2-15-11(14)10(12)7-8-3-5-9(13)6-4-8;/h3-6,10,13H,2,7,12H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 161.4oC |
| Boiling Point: | 343.3 oC at 760 mmHg |
| Density: | 1.177 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | White to off-white crystalline powder |
| Packinggroup: | III |
| Flash Point: | 161.4oC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
