Identification |
Name: | L-Norvaline, ethylester, hydrochloride (1:1) |
Synonyms: | L-Norvaline,ethyl ester, hydrochloride (9CI); |
CAS: | 40918-51-2 |
Molecular Formula: | C7H15NO2.HCl |
Molecular Weight: | 181.66 |
InChI: | InChI=1/C7H15NO2.ClH/c1-3-5-6(8)7(9)10-4-2;/h6H,3-5,8H2,1-2H3;1H/t6-;/m0./s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 48.4°C |
Boiling Point: | 175.4°C at 760 mmHg |
Specification: |
The chemical synonyms of L-Norvaline ethyl ester hydrochloride (40918-51-2) are L-norvaline ethyl ester hcl ; L-2-aminovaleric acid-ethyl ester hcl ; H-nva-oet hcl ; L-norvaline ethyl ester hydrochloride .
|
Flash Point: | 48.4°C |
Safety Data |
|
|