| Identification | |
| Name: | -Valprolactone |
| CAS: | 40923-58-8 |
| Molecular Formula: | C8H14O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H14O2/c1-3-4-7-5-6(2)10-8(7)9/h6-7H,3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 88.4°C |
| Boiling Point: | 232.3°C at 760 mmHg |
| Density: | 0.945g/cm3 |
| Refractive index: | 1.43 |
| Specification: | Colourless Liquid usageEng:A metabolite of valproic acid |
| Flash Point: | 88.4°C |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of valproic acid |
| Safety Data | |
 |
|
