| Identification | |
| Name: | Benzoic acid,4-(acetylamino)-2-hydroxy-, methyl ester |
| Synonyms: | Salicylicacid, 4-acetamido-, methyl ester (7CI,8CI); 4-(Acetylamino)-2-hydroxybenzoicacid methyl ester; 4-Acetylaminosalicylic acid methyl ester; Methyl2-hydroxy-4-(acetylamino)benzoate; Methyl 2-hydroxy-4-acetamidobenzoate; Methyl4-(acetylamino)-2-hydroxybenzoate; Methyl 4-(acetylamino)salicylate; Methyl4-acetamido-2-hydroxybenzoate; Methyl 4-acetamidosalicylate |
| CAS: | 4093-28-1 |
| EINECS: | 223-838-0 |
| Molecular Formula: | C10H11 N O4 |
| Molecular Weight: | 223.23 |
| InChI: | InChI=1/C10H11NO4/c1-6(12)11-7-3-4-8(9(13)5-7)10(14)15-2/h3-5,13H,1-2H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 198.8°C |
| Boiling Point: | 405.1°Cat760mmHg |
| Density: | 1.317g/cm3 |
| Refractive index: | 1.597 |
| Specification: | Light Brown Solid usageEng:Reagent used in the synthesis of Mosapride. |
| Flash Point: | 198.8°C |
| Storage Temperature: | Refrigerator |
| Usage: | Reagent used in the synthesis of Mosapride. |
| Safety Data | |
 |
|
