Identification |
Name: | Phenarsazine,10,10'-oxybis[5,10-dihydro- |
Synonyms: | Bis(5,10-dihydro-10-phenarsazinyl)oxide; Bis(5,10-dihydrophenarsazine) oxide |
CAS: | 4095-45-8 |
Molecular Formula: | C24H18 As2 N2 O |
Molecular Weight: | 500.28 |
InChI: | InChI=1/C24H18As2N2O/c1-5-13-21-17(9-1)25(18-10-2-6-14-22(18)27-21)29-26-19-11-3-7-15-23(19)28-24-16-8-4-12-20(24)26/h1-16,27-28H |
Molecular Structure: |
|
Properties |
Flash Point: | 243.9°C |
Boiling Point: | 582.6°Cat760mmHg |
Density: | g/cm3 |
Specification: |
Descriptors computed from structure, you can know some information about Phenarsazine oxide (CAS NO.4095-45-8) :
Canonical SMILES: C1=CC=C2C(=C1)NC3=CC=CC=C3[As]2O[As]4C5=CC=CC=C5NC6=CC=CC=C64
InChI: InChI=1S/C24H18As2N2O/c1-5-13-21-17(9-1)25(18-10-2-6-14-22(18)27-21)29-26-19-11-3-7-15-23(19)28-24-16-8-4-12-20(24)26/h1-16,27-28H
InChIKey: SDMIOFRAYIQSKO-UHFFFAOYSA-N
|
Report: |
Arsenic and its compounds are on the Community Right-To-Know List.
|
Flash Point: | 243.9°C |
Safety Data |
|
|