| Identification | |
| Name: | Pentanedioic acid,2-hydroxy-, sodium salt (1:2) |
| Synonyms: | Glutaricacid, 2-hydroxy-, disodium salt (7CI); Pentanedioic acid, 2-hydroxy-, disodiumsalt (9CI); Sodium a-hydroxyglutarate |
| CAS: | 40951-21-1 |
| Molecular Formula: | C5H8 O5 . 2 Na |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H8O5.2Na/c6-3(5(9)10)1-2-4(7)8;;/h3,6H,1-2H2,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >290?C (dec.) |
| Flash Point: | 206.4°C |
| Boiling Point: | 394.2°Cat760mmHg |
| Density: | 1.508g/cm3 |
| Specification: | White to Off-White Solid usageEng:A potential inhibitor of glutamate carboxypeptidase. |
| Flash Point: | 206.4°C |
| Usage: | A potential inhibitor of glutamate carboxypeptidase. |
| Safety Data | |
 |
|
