| Identification | |
| Name: | Piperidine, 1-phenyl- |
| Synonyms: | 1-Phenylpiperidine;N-Phenylpiperidine;NSC 53427; |
| CAS: | 4096-20-2 |
| EINECS: | 223-848-5 |
| Molecular Formula: | C11H15N |
| Molecular Weight: | 161.25 |
| InChI: | InChI=1/C11H15N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3-4,7-8H,2,5-6,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 3-4 ºC |
| Density: | 0.997 g/cm3 |
| Refractive index: | 1.544 |
| Water Solubility: | SOLUBLE IN ALCOHOL, ETHER,benzene,chloroform |
| Solubility: | SOLUBLE IN ALCOHOL, ETHER,benzene,chloroform |
| Specification: |
The N-Phenylpiperidine, with the cas registry number 4096-20-2 and the EINECS registy number of 223-848-5, has the systematic name and IUPAC name of 1-phenylpiperidine. And the molecular formula of the chemical is C11H15N. The characteristics of this chemical are as followings: (1)ACD/LogP: 2.98; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.58; (4)ACD/LogD (pH 7.4): 2.97; (5)ACD/BCF (pH 5.5): 43.47; (6)ACD/BCF (pH 7.4): 106.33; (7)ACD/KOC (pH 5.5): 399.45; (8)ACD/KOC (pH 7.4): 977.23; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 3.24 Å2; (13)Index of Refraction: 1.544; (14)Molar Refractivity: 51.06 cm3; (15)Molar Volume: 161.7 cm3; (16)Polarizability: 20.24×10-24cm3; (17)Surface Tension: 37.7 dyne/cm; (18)Density: 0.997 g/cm3; (19)Flash Point: 106.1 °C; (20)Enthalpy of Vaporization: 49.56 kJ/mol; (21)Boiling Point: 258 °C at 760 mmHg; (22)Vapour Pressure: 0.0141 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
