| Identification | |
| Name: | Adenosine,2',3'-dideoxy- |
| Synonyms: | 2',3'-Dideoxyadenosine;NSC 98700; |
| CAS: | 4097-22-7 |
| EINECS: | 223-853-2 |
| Molecular Formula: | C10H13N5O2 |
| Molecular Weight: | 235.24252 |
| InChI: | InChI=1S/C10H13N5O2/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(3-16)17-7/h4-7,16H,1-3H2,(H2,11,12,13)/t6-,7+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 539.1ºC at 760 mmHg |
| Boiling Point: | 539.1ºC at 760 mmHg |
| Density: | 1.76 g/cm3 |
| Stability: | No data. |
| Refractive index: | -34 ° (C=1, H2O) |
| Water Solubility: | soluble (soluble in caustic soda) |
| Solubility: | 539.1ºC at 760 mmHg |
| Appearance: | white crystalline powder |
| Specification: | usageEng:A potent labelled anti-HIV agent. Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 539.1ºC at 760 mmHg |
| Storage Temperature: | 2-8°C |
| Usage: | Anti-aids drug. |
| Safety Data | |
| Hazard Symbols | |
 |
|
