| Identification | |
| Name: | 1,2-Ethanediamine,N1-(2-aminoethyl)-N1-methyl- |
| Synonyms: | 1,2-Ethanediamine,N-(2-aminoethyl)-N-methyl- (9CI); Diethylenetriamine, 4-methyl- (6CI,7CI,8CI);1,5-Diamino-3-methyl-3-azapentane; 1,5-Diamino-N'-methyl-3-azapentane;2,2'-Diamino-N-methyldiethylamine; 4-Methyl-1,4,7-triazaheptane;4-Methyldiethylenetriamine; Bis(2-aminoethyl)methylamine;N,N-Bis(2-aminoethyl)methylamine; N,N-Bis(b-aminoethyl)methylamine; N-(2-Aminoethyl)-N-methyl-1,2-ethanediamine;N-(2-Aminoethyl)-N-methylethylenediamine; N2-Methyldiethylenetriamine;N'-Methyl-2,2'-diaminodiethylamine; N'-Methyldiethylenetriamine |
| CAS: | 4097-88-5 |
| Molecular Formula: | C5H15 N3 |
| Molecular Weight: | 117.19 |
| InChI: | InChI=1/C5H15N3/c1-8(4-2-6)5-3-7/h2-7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2735 |
| Flash Point: | 84°C |
| Boiling Point: | 84 °C / 14mmHg |
| Density: | 0,91 g/cm3 |
| Refractive index: | 1.484 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 84°C |
| Safety Data | |
 |
|
