| Identification | |
| Name: | Morpholine,2-(chloromethyl)-4-(phenylmethyl)- |
| Synonyms: | 2-(Chloromethyl)-4-(phenylmethyl)morpholine;2-(Chloromethyl)-4-benzylmorpholine; 4-Benzyl-2-(chloromethyl)morpholine;N-Benzyl-2-(chloromethyl)morpholine |
| CAS: | 40987-25-5 |
| Molecular Formula: | C12H16 Cl N O |
| Molecular Weight: | 225.7145 |
| InChI: | InChI=1/C12H16ClNO/c13-8-12-10-14(6-7-15-12)9-11-4-2-1-3-5-11/h1-5,12H,6-10H2/p+1/t12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 46 ºC |
| Flash Point: | 144.1ºC |
| Boiling Point: | 120-122ºC 1mm |
| Density: | 1.132 g/cm3 |
| Refractive index: | 1.537 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 144.1ºC |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
