Identification |
Name: | 5'-IODO-5'-DEOXYADENOSINE |
Synonyms: | 5'-DEOXY-5'-IODO-ADENOSINE;5'-IODO-5'-DEOXYADENOSINE;5'-Deoxy-5'-iodo-D-adenosine;5''-IODO-5''-DEOXYADENOSINE 95%;5''-DEOXY-5''-JOD-ADENOSINE;5'-Iodo-5'-deoxyadenosine,95%;5'-Iodo-5'-deoxyadenosine,99+% |
CAS: | 4099-81-4 |
EINECS: | 223-864-2 |
Molecular Formula: | C10H12IN5O3 |
Molecular Weight: | 377.14 |
InChI: | InChI=1/C10H12IN5O3/c11-1-4-6(17)7(18)10(19-4)16-3-15-5-8(12)13-2-14-9(5)16/h2-4,6-7,10,17-18H,1H2,(H2,12,13,14)/t4-,6-,7-,10-/m1/s1 |
Molecular Structure: |
|
Properties |
Melting Point: | 178-187 °C |
Flash Point: | 359.7°C |
Boiling Point: | 671.1°C at 760 mmHg |
Density: | 2.53g/cm3 |
Refractive index: | 1.95 |
Specification: | off-white to beige crystalline powder usageEng:Important precursors for the synthesis of nucleotides, sugar nucleosides and as biologically active substances Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Flash Point: | 359.7°C |
Storage Temperature: | -20°C |
Usage: | Important precursors for the synthesis of nucleotides, sugar nucleosides and as biologically active substances |
Safety Data |
|
|